C15H28N2O4S — CID 107239046
tert-butyl N-[3-[(2-methylsulfonylcyclopentyl)amino]cyclobutyl]carbamate (PubChem CID 107239046) has the molecular formula C15H28N2O4S and a molecular weight of 332.47 g/mol. Its IUPAC name is tert-butyl N-[3-[(2-methylsulfonylcyclopentyl)amino]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[(2-methylsulfonylcyclopentyl)amino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 107239046 |
| Molecular Formula | C15H28N2O4S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | tert-butyl N-[3-[(2-methylsulfonylcyclopentyl)amino]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(NC2CCCC2S(C)(=O)=O)C1 |
| InChI | InChI=1S/C15H28N2O4S/c1-15(2,3)21-14(18)17-11-8-10(9-11)16-12-6-5-7-13(12)22(4,19)20/h10-13,16H,5-9H2,1-4H3,(H,17,18) |
| InChIKey | ALANTLFMGKMWCP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |