C48H58N2O7 — CID 10723907
(3aS,4R,8R,8aS)-4,8-dibenzyl-2,2-dimethyl-5,7-bis[[4-(oxan-2-yloxymethyl)phenyl]methyl]-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-6-one (PubChem CID 10723907) has the molecular formula C48H58N2O7 and a molecular weight of 775.00 g/mol. Its IUPAC name is (3aS,4R,8R,8aS)-4,8-dibenzyl-2,2-dimethyl-5,7-bis[[4-(oxan-2-yloxymethyl)phenyl]methyl]-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-6-one.
| Compound Name | (3aS,4R,8R,8aS)-4,8-dibenzyl-2,2-dimethyl-5,7-bis[[4-(oxan-2-yloxymethyl)phenyl]methyl]-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-6-one |
|---|---|
| PubChem CID | 10723907 |
| Molecular Formula | C48H58N2O7 |
| Molecular Weight | 775.00 g/mol |
| Exact Mass | 774.42 |
| IUPAC Name | (3aS,4R,8R,8aS)-4,8-dibenzyl-2,2-dimethyl-5,7-bis[[4-(oxan-2-yloxymethyl)phenyl]methyl]-3a,4,8,8a-tetrahydro-[1,3]dioxolo[4,5-e][1,3]diazepin-6-one |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@@H](Cc1ccccc1)N(Cc1ccc(COC3CCCCO3)cc1)C(=O)N(Cc1ccc(COC3CCCCO3)cc1)[C@@H]2Cc1ccccc1 |
| InChI | InChI=1S/C48H58N2O7/c1-48(2)56-45-41(29-35-13-5-3-6-14-35)49(31-37-19-23-39(24-20-37)33-54-43-17-9-11-27-52-43)47(51)50(42(46(45)57-48)30-36-15-7-4-8-16-36)32-38-21-25-40(26-22-38)34-55-44-18-10-12-28-53-44/h3-8,13-16,19-26,41-46H,9-12,17-18,27-34H2,1-2H3/t41-,42-,43?,44?,45+,46+/m1/s1 |
| InChIKey | JOZRSMWTELVCOK-HYAVFZCESA-N |
| XLogP | 8.95 |
| TPSA | 78.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.00 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |