C16H23BrN2O3 — CID 107239083
tert-butyl N-[3-[(3-bromo-2-hydroxyphenyl)methylamino]cyclobutyl]carbamate (PubChem CID 107239083) has the molecular formula C16H23BrN2O3 and a molecular weight of 371.28 g/mol. Its IUPAC name is tert-butyl N-[3-[(3-bromo-2-hydroxyphenyl)methylamino]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[(3-bromo-2-hydroxyphenyl)methylamino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 107239083 |
| Molecular Formula | C16H23BrN2O3 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | tert-butyl N-[3-[(3-bromo-2-hydroxyphenyl)methylamino]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(NCc2cccc(Br)c2O)C1 |
| InChI | InChI=1S/C16H23BrN2O3/c1-16(2,3)22-15(21)19-12-7-11(8-12)18-9-10-5-4-6-13(17)14(10)20/h4-6,11-12,18,20H,7-9H2,1-3H3,(H,19,21) |
| InChIKey | PXDIHMGEMIJZSS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|