C17H26N2O4 — CID 107239371
tert-butyl 3-[1-(2,4-dihydroxyphenyl)ethylamino]pyrrolidine-1-carboxylate (PubChem CID 107239371) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is tert-butyl 3-[1-(2,4-dihydroxyphenyl)ethylamino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-(2,4-dihydroxyphenyl)ethylamino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 107239371 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | tert-butyl 3-[1-(2,4-dihydroxyphenyl)ethylamino]pyrrolidine-1-carboxylate |
| SMILES | CC(NC1CCN(C(=O)OC(C)(C)C)C1)c1ccc(O)cc1O |
| InChI | InChI=1S/C17H26N2O4/c1-11(14-6-5-13(20)9-15(14)21)18-12-7-8-19(10-12)16(22)23-17(2,3)4/h5-6,9,11-12,18,20-21H,7-8,10H2,1-4H3 |
| InChIKey | LNVPOCQAXDVUQT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|