C37H70N8O10 — CID 10723965
tert-butyl N-[4-[[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-oxoethyl]carbamoylamino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate (PubChem CID 10723965) has the molecular formula C37H70N8O10 and a molecular weight of 787.01 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-oxoethyl]carbamoylamino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-oxoethyl]carbamoylamino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
|---|---|
| PubChem CID | 10723965 |
| Molecular Formula | C37H70N8O10 |
| Molecular Weight | 787.01 g/mol |
| Exact Mass | 786.52 |
| IUPAC Name | tert-butyl N-[4-[[2-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-2-oxoethyl]carbamoylamino]butyl]-N-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN(CCCCNC(=O)NCC(=O)NCCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C37H70N8O10/c1-34(2,3)52-30(48)41-23-19-25-45(33(51)55-37(10,11)12)24-18-17-22-40-29(47)42-26-27(46)38-20-15-13-14-16-21-39-28(43-31(49)53-35(4,5)6)44-32(50)54-36(7,8)9/h13-26H2,1-12H3,(H,38,46)(H,41,48)(H2,40,42,47)(H2,39,43,44,49,50) |
| InChIKey | JBMUKTIBUKIGDD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 227.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.01 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|