C17H27N3O2 — CID 107244669
tert-butyl N-[[3-(piperidin-3-ylamino)phenyl]methyl]carbamate (PubChem CID 107244669) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is tert-butyl N-[[3-(piperidin-3-ylamino)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-(piperidin-3-ylamino)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 107244669 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | tert-butyl N-[[3-(piperidin-3-ylamino)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(NC2CCCNC2)c1 |
| InChI | InChI=1S/C17H27N3O2/c1-17(2,3)22-16(21)19-11-13-6-4-7-14(10-13)20-15-8-5-9-18-12-15/h4,6-7,10,15,18,20H,5,8-9,11-12H2,1-3H3,(H,19,21) |
| InChIKey | YQEKGPOKQWFAAB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |