C17H30N4O2 — CID 107246802
tert-butyl 2-[[(3-ethylimidazol-4-yl)methylamino]methyl]piperidine-1-carboxylate (PubChem CID 107246802) has the molecular formula C17H30N4O2 and a molecular weight of 322.45 g/mol. Its IUPAC name is tert-butyl 2-[[(3-ethylimidazol-4-yl)methylamino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(3-ethylimidazol-4-yl)methylamino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 107246802 |
| Molecular Formula | C17H30N4O2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | tert-butyl 2-[[(3-ethylimidazol-4-yl)methylamino]methyl]piperidine-1-carboxylate |
| SMILES | CCn1cncc1CNCC1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H30N4O2/c1-5-20-13-19-12-15(20)11-18-10-14-8-6-7-9-21(14)16(22)23-17(2,3)4/h12-14,18H,5-11H2,1-4H3 |
| InChIKey | LAOHAHAKKUJNCJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |