C17H33N3O2 — CID 107246835
tert-butyl 2-[(piperidin-4-ylmethylamino)methyl]piperidine-1-carboxylate (PubChem CID 107246835) has the molecular formula C17H33N3O2 and a molecular weight of 311.47 g/mol. Its IUPAC name is tert-butyl 2-[(piperidin-4-ylmethylamino)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(piperidin-4-ylmethylamino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 107246835 |
| Molecular Formula | C17H33N3O2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | tert-butyl 2-[(piperidin-4-ylmethylamino)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1CNCC1CCNCC1 |
| InChI | InChI=1S/C17H33N3O2/c1-17(2,3)22-16(21)20-11-5-4-6-15(20)13-19-12-14-7-9-18-10-8-14/h14-15,18-19H,4-13H2,1-3H3 |
| InChIKey | OSWSDCXRIXKSJX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |