C16H29F3N2O2 — CID 107247100
tert-butyl N-[4-[[2-(trifluoromethyl)cyclohexyl]amino]butan-2-yl]carbamate (PubChem CID 107247100) has the molecular formula C16H29F3N2O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-(trifluoromethyl)cyclohexyl]amino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-(trifluoromethyl)cyclohexyl]amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 107247100 |
| Molecular Formula | C16H29F3N2O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | tert-butyl N-[4-[[2-(trifluoromethyl)cyclohexyl]amino]butan-2-yl]carbamate |
| SMILES | CC(CCNC1CCCCC1C(F)(F)F)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29F3N2O2/c1-11(21-14(22)23-15(2,3)4)9-10-20-13-8-6-5-7-12(13)16(17,18)19/h11-13,20H,5-10H2,1-4H3,(H,21,22) |
| InChIKey | AGTSTRFLDHDGDM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |