About 4-thiophen-2-ylaniline
4-thiophen-2-ylaniline (PubChem CID 1072474) has the molecular formula C10H9NS
and a molecular weight of 175.26 g/mol. Its IUPAC name is 4-thiophen-2-ylaniline.
Molecular Properties
| Compound Name | 4-thiophen-2-ylaniline |
| PubChem CID | 1072474 |
| Molecular Formula | C10H9NS |
| Molecular Weight | 175.26 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 4-thiophen-2-ylaniline |
| SMILES | Nc1ccc(-c2cccs2)cc1 |
| InChI | InChI=1S/C10H9NS/c11-9-5-3-8(4-6-9)10-2-1-7-12-10/h1-7H,11H2 |
| InChIKey | WPNWHSQJRALLBJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-thiophen-2-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-thiophen-2-ylaniline?
The IUPAC name of 4-thiophen-2-ylaniline (CID 1072474) is 4-thiophen-2-ylaniline.
What is the SMILES notation for 4-thiophen-2-ylaniline?
The canonical SMILES for 4-thiophen-2-ylaniline is Nc1ccc(-c2cccs2)cc1.
What is the InChIKey of 4-thiophen-2-ylaniline?
The InChIKey is WPNWHSQJRALLBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NS/c11-9-5-3-8(4-6-9)10-2-1-7-12-10/h1-7H,11H2.
What are the key properties of 4-thiophen-2-ylaniline?
4-thiophen-2-ylaniline has a molecular weight of 175.26 g/mol, XLogP of 3.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-thiophen-2-ylaniline is sourced from PubChem (CID 1072474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).