C16H25IN2O2S — CID 107247424
tert-butyl N-[1-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]propan-2-yl]carbamate (PubChem CID 107247424) has the molecular formula C16H25IN2O2S and a molecular weight of 436.36 g/mol. Its IUPAC name is tert-butyl N-[1-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 107247424 |
| Molecular Formula | C16H25IN2O2S |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | tert-butyl N-[1-[(2-iodo-4,5,6,7-tetrahydro-1-benzothiophen-4-yl)amino]propan-2-yl]carbamate |
| SMILES | CC(CNC1CCCc2sc(I)cc21)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25IN2O2S/c1-10(19-15(20)21-16(2,3)4)9-18-12-6-5-7-13-11(12)8-14(17)22-13/h8,10,12,18H,5-7,9H2,1-4H3,(H,19,20) |
| InChIKey | FGVNTGKSLNBPEV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|