C16H28N4O3 — CID 107249498
tert-butyl 3-[[(3-ethylimidazol-4-yl)methylamino]methyl]morpholine-4-carboxylate (PubChem CID 107249498) has the molecular formula C16H28N4O3 and a molecular weight of 324.43 g/mol. Its IUPAC name is tert-butyl 3-[[(3-ethylimidazol-4-yl)methylamino]methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 3-[[(3-ethylimidazol-4-yl)methylamino]methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 107249498 |
| Molecular Formula | C16H28N4O3 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | tert-butyl 3-[[(3-ethylimidazol-4-yl)methylamino]methyl]morpholine-4-carboxylate |
| SMILES | CCn1cncc1CNCC1COCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28N4O3/c1-5-19-12-18-9-13(19)8-17-10-14-11-22-7-6-20(14)15(21)23-16(2,3)4/h9,12,14,17H,5-8,10-11H2,1-4H3 |
| InChIKey | SKHPWGAJNJXODG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |