C52H22F24N4 — CID 10724982
5,10,15,20-tetrakis[3,5-bis(trifluoromethyl)phenyl]-21,22-dihydroporphyrin (PubChem CID 10724982) has the molecular formula C52H22F24N4 and a molecular weight of 1158.73 g/mol. Its IUPAC name is 5,10,15,20-tetrakis[3,5-bis(trifluoromethyl)phenyl]-21,22-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis[3,5-bis(trifluoromethyl)phenyl]-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10724982 |
| Molecular Formula | C52H22F24N4 |
| Molecular Weight | 1158.73 g/mol |
| Exact Mass | 1158.15 |
| IUPAC Name | 5,10,15,20-tetrakis[3,5-bis(trifluoromethyl)phenyl]-21,22-dihydroporphyrin |
| SMILES | FC(F)(F)c1cc(-c2c3nc(c(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)c4ccc([nH]4)c(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)c4ccc([nH]4)c(-c4cc(C(F)(F)F)cc(C(F)(F)F)c4)c4nc2C=C4)C=C3)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C52H22F24N4/c53-45(54,55)25-9-21(10-26(17-25)46(56,57)58)41-33-1-2-34(77-33)42(22-11-27(47(59,60)61)18-28(12-22)48(62,63)64)36-5-6-38(79-36)44(24-15-31(51(71,72)73)20-32(16-24)52(74,75)76)40-8-7-39(80-40)43(37-4-3-35(41)78-37)23-13-29(49(65,66)67)19-30(14-23)50(68,69)70/h1-20,77-78H/b41-33-,41-35-,42-34-,42-36-,43-37-,43-39-,44-38-,44-40- |
| InChIKey | ANHHZSJBWMHYSF-JAAFTSFNSA-N |
| XLogP | 19.47 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1158.73 |
| LogP ≤ 5 | 19.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |