C19H38N2O2 — CID 107251671
tert-butyl N-[3-[[(4-methylcycloheptyl)amino]methyl]pentan-3-yl]carbamate (PubChem CID 107251671) has the molecular formula C19H38N2O2 and a molecular weight of 326.53 g/mol. Its IUPAC name is tert-butyl N-[3-[[(4-methylcycloheptyl)amino]methyl]pentan-3-yl]carbamate.
| Compound Name | tert-butyl N-[3-[[(4-methylcycloheptyl)amino]methyl]pentan-3-yl]carbamate |
|---|---|
| PubChem CID | 107251671 |
| Molecular Formula | C19H38N2O2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.29 |
| IUPAC Name | tert-butyl N-[3-[[(4-methylcycloheptyl)amino]methyl]pentan-3-yl]carbamate |
| SMILES | CCC(CC)(CNC1CCCC(C)CC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H38N2O2/c1-7-19(8-2,21-17(22)23-18(4,5)6)14-20-16-11-9-10-15(3)12-13-16/h15-16,20H,7-14H2,1-6H3,(H,21,22) |
| InChIKey | AXSSULWAOUIGGP-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |