C15H28N2O3S — CID 107251822
tert-butyl N-[2-cyclopropyl-2-[(1-oxothian-4-yl)amino]ethyl]carbamate (PubChem CID 107251822) has the molecular formula C15H28N2O3S and a molecular weight of 316.47 g/mol. Its IUPAC name is tert-butyl N-[2-cyclopropyl-2-[(1-oxothian-4-yl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-cyclopropyl-2-[(1-oxothian-4-yl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 107251822 |
| Molecular Formula | C15H28N2O3S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | tert-butyl N-[2-cyclopropyl-2-[(1-oxothian-4-yl)amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(NC1CCS(=O)CC1)C1CC1 |
| InChI | InChI=1S/C15H28N2O3S/c1-15(2,3)20-14(18)16-10-13(11-4-5-11)17-12-6-8-21(19)9-7-12/h11-13,17H,4-10H2,1-3H3,(H,16,18) |
| InChIKey | WMJIZHAUDJHFQH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |