C18H38N2O2 — CID 107252599
tert-butyl N-[2-(2-ethylbutylamino)-2,4-dimethylpentyl]carbamate (PubChem CID 107252599) has the molecular formula C18H38N2O2 and a molecular weight of 314.51 g/mol. Its IUPAC name is tert-butyl N-[2-(2-ethylbutylamino)-2,4-dimethylpentyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-ethylbutylamino)-2,4-dimethylpentyl]carbamate |
|---|---|
| PubChem CID | 107252599 |
| Molecular Formula | C18H38N2O2 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.29 |
| IUPAC Name | tert-butyl N-[2-(2-ethylbutylamino)-2,4-dimethylpentyl]carbamate |
| SMILES | CCC(CC)CNC(C)(CNC(=O)OC(C)(C)C)CC(C)C |
| InChI | InChI=1S/C18H38N2O2/c1-9-15(10-2)12-20-18(8,11-14(3)4)13-19-16(21)22-17(5,6)7/h14-15,20H,9-13H2,1-8H3,(H,19,21) |
| InChIKey | DNBRMNPFNGJQAB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |