About 4-butan-2-yl-4H-pyran
4-butan-2-yl-4H-pyran (PubChem CID 10725412) has the molecular formula C9H14O
and a molecular weight of 138.21 g/mol. Its IUPAC name is 4-butan-2-yl-4H-pyran.
Molecular Properties
| Compound Name | 4-butan-2-yl-4H-pyran |
| PubChem CID | 10725412 |
| Molecular Formula | C9H14O |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.10 |
| IUPAC Name | 4-butan-2-yl-4H-pyran |
| SMILES | CCC(C)C1C=COC=C1 |
| InChI | InChI=1S/C9H14O/c1-3-8(2)9-4-6-10-7-5-9/h4-9H,3H2,1-2H3 |
| InChIKey | QTNDZOZFTIPRTD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-butan-2-yl-4H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yl-4H-pyran?
The IUPAC name of 4-butan-2-yl-4H-pyran (CID 10725412) is 4-butan-2-yl-4H-pyran.
What is the SMILES notation for 4-butan-2-yl-4H-pyran?
The canonical SMILES for 4-butan-2-yl-4H-pyran is CCC(C)C1C=COC=C1.
What is the InChIKey of 4-butan-2-yl-4H-pyran?
The InChIKey is QTNDZOZFTIPRTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O/c1-3-8(2)9-4-6-10-7-5-9/h4-9H,3H2,1-2H3.
What are the key properties of 4-butan-2-yl-4H-pyran?
4-butan-2-yl-4H-pyran has a molecular weight of 138.21 g/mol, XLogP of 2.71, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yl-4H-pyran is sourced from PubChem (CID 10725412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).