About furo[3,2-b]pyridine-5-carbaldehyde
furo[3,2-b]pyridine-5-carbaldehyde (PubChem CID 10725492) has the molecular formula C8H5NO2
and a molecular weight of 147.13 g/mol. Its IUPAC name is furo[3,2-b]pyridine-5-carbaldehyde.
Molecular Properties
| Compound Name | furo[3,2-b]pyridine-5-carbaldehyde |
| PubChem CID | 10725492 |
| Molecular Formula | C8H5NO2 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.03 |
| IUPAC Name | furo[3,2-b]pyridine-5-carbaldehyde |
| SMILES | O=Cc1ccc2occc2n1 |
| InChI | InChI=1S/C8H5NO2/c10-5-6-1-2-8-7(9-6)3-4-11-8/h1-5H |
| InChIKey | WIQLXNIFMGGVKJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze furo[3,2-b]pyridine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furo[3,2-b]pyridine-5-carbaldehyde?
The IUPAC name of furo[3,2-b]pyridine-5-carbaldehyde (CID 10725492) is furo[3,2-b]pyridine-5-carbaldehyde.
What is the SMILES notation for furo[3,2-b]pyridine-5-carbaldehyde?
The canonical SMILES for furo[3,2-b]pyridine-5-carbaldehyde is O=Cc1ccc2occc2n1.
What is the InChIKey of furo[3,2-b]pyridine-5-carbaldehyde?
The InChIKey is WIQLXNIFMGGVKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2/c10-5-6-1-2-8-7(9-6)3-4-11-8/h1-5H.
What are the key properties of furo[3,2-b]pyridine-5-carbaldehyde?
furo[3,2-b]pyridine-5-carbaldehyde has a molecular weight of 147.13 g/mol, XLogP of 1.64, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furo[3,2-b]pyridine-5-carbaldehyde is sourced from PubChem (CID 10725492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).