About ethyl 2,3-dicyanopropanoate
ethyl 2,3-dicyanopropanoate (PubChem CID 10725530) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is ethyl 2,3-dicyanopropanoate.
Molecular Properties
| Compound Name | ethyl 2,3-dicyanopropanoate |
| PubChem CID | 10725530 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | ethyl 2,3-dicyanopropanoate |
| SMILES | CCOC(=O)C(C#N)CC#N |
| InChI | InChI=1S/C7H8N2O2/c1-2-11-7(10)6(5-9)3-4-8/h6H,2-3H2,1H3 |
| InChIKey | NPZOLWMDTPEVEI-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2,3-dicyanopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,3-dicyanopropanoate?
The IUPAC name of ethyl 2,3-dicyanopropanoate (CID 10725530) is ethyl 2,3-dicyanopropanoate.
What is the SMILES notation for ethyl 2,3-dicyanopropanoate?
The canonical SMILES for ethyl 2,3-dicyanopropanoate is CCOC(=O)C(C#N)CC#N.
What is the InChIKey of ethyl 2,3-dicyanopropanoate?
The InChIKey is NPZOLWMDTPEVEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c1-2-11-7(10)6(5-9)3-4-8/h6H,2-3H2,1H3.
What are the key properties of ethyl 2,3-dicyanopropanoate?
ethyl 2,3-dicyanopropanoate has a molecular weight of 152.15 g/mol, XLogP of 0.60, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,3-dicyanopropanoate is sourced from PubChem (CID 10725530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).