C18H32N2O2 — CID 107256493
tert-butyl N-[2-(6-bicyclo[3.2.0]hept-3-enylamino)hexyl]carbamate (PubChem CID 107256493) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is tert-butyl N-[2-(6-bicyclo[3.2.0]hept-3-enylamino)hexyl]carbamate.
| Compound Name | tert-butyl N-[2-(6-bicyclo[3.2.0]hept-3-enylamino)hexyl]carbamate |
|---|---|
| PubChem CID | 107256493 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | tert-butyl N-[2-(6-bicyclo[3.2.0]hept-3-enylamino)hexyl]carbamate |
| SMILES | CCCCC(CNC(=O)OC(C)(C)C)NC1CC2CC=CC21 |
| InChI | InChI=1S/C18H32N2O2/c1-5-6-9-14(12-19-17(21)22-18(2,3)4)20-16-11-13-8-7-10-15(13)16/h7,10,13-16,20H,5-6,8-9,11-12H2,1-4H3,(H,19,21) |
| InChIKey | BQFLVVRLLGFHMA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|