C16H30N4O3 — CID 107256905
tert-butyl N-[2-[(3-ethylimidazol-4-yl)methylamino]ethyl]-N-(2-methoxyethyl)carbamate (PubChem CID 107256905) has the molecular formula C16H30N4O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-ethylimidazol-4-yl)methylamino]ethyl]-N-(2-methoxyethyl)carbamate.
| Compound Name | tert-butyl N-[2-[(3-ethylimidazol-4-yl)methylamino]ethyl]-N-(2-methoxyethyl)carbamate |
|---|---|
| PubChem CID | 107256905 |
| Molecular Formula | C16H30N4O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | tert-butyl N-[2-[(3-ethylimidazol-4-yl)methylamino]ethyl]-N-(2-methoxyethyl)carbamate |
| SMILES | CCn1cncc1CNCCN(CCOC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H30N4O3/c1-6-19-13-18-12-14(19)11-17-7-8-20(9-10-22-5)15(21)23-16(2,3)4/h12-13,17H,6-11H2,1-5H3 |
| InChIKey | LBDODCJTEROBFX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|