About 2,4,5-trifluorobenzene-1,3-diol
2,4,5-trifluorobenzene-1,3-diol (PubChem CID 10725692) has the molecular formula C6H3F3O2
and a molecular weight of 164.08 g/mol. Its IUPAC name is 2,4,5-trifluorobenzene-1,3-diol.
Molecular Properties
| Compound Name | 2,4,5-trifluorobenzene-1,3-diol |
| PubChem CID | 10725692 |
| Molecular Formula | C6H3F3O2 |
| Molecular Weight | 164.08 g/mol |
| Exact Mass | 164.01 |
| IUPAC Name | 2,4,5-trifluorobenzene-1,3-diol |
| SMILES | Oc1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C6H3F3O2/c7-2-1-3(10)5(9)6(11)4(2)8/h1,10-11H |
| InChIKey | ULPUUNVDJJXSRH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.08 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 2,4,5-trifluorobenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5-trifluorobenzene-1,3-diol?
The IUPAC name of 2,4,5-trifluorobenzene-1,3-diol (CID 10725692) is 2,4,5-trifluorobenzene-1,3-diol.
What is the SMILES notation for 2,4,5-trifluorobenzene-1,3-diol?
The canonical SMILES for 2,4,5-trifluorobenzene-1,3-diol is Oc1cc(F)c(F)c(O)c1F.
What is the InChIKey of 2,4,5-trifluorobenzene-1,3-diol?
The InChIKey is ULPUUNVDJJXSRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F3O2/c7-2-1-3(10)5(9)6(11)4(2)8/h1,10-11H.
What are the key properties of 2,4,5-trifluorobenzene-1,3-diol?
2,4,5-trifluorobenzene-1,3-diol has a molecular weight of 164.08 g/mol, XLogP of 1.52, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-trifluorobenzene-1,3-diol is sourced from PubChem (CID 10725692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).