C13H26N2O2 — CID 107257589
N-(6-hydroxyhexyl)-3-methylpiperidine-1-carboxamide (PubChem CID 107257589) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is N-(6-hydroxyhexyl)-3-methylpiperidine-1-carboxamide.
| Compound Name | N-(6-hydroxyhexyl)-3-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 107257589 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | N-(6-hydroxyhexyl)-3-methylpiperidine-1-carboxamide |
| SMILES | CC1CCCN(C(=O)NCCCCCCO)C1 |
| InChI | InChI=1S/C13H26N2O2/c1-12-7-6-9-15(11-12)13(17)14-8-4-2-3-5-10-16/h12,16H,2-11H2,1H3,(H,14,17) |
| InChIKey | AYPPWTMUZKQPMY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|