About 1-N-(1,3-benzodioxol-5-ylmethyl)-2-fluoro-5-methoxybenzene-1,4-diamine
1-N-(1,3-benzodioxol-5-ylmethyl)-2-fluoro-5-methoxybenzene-1,4-diamine (PubChem CID 107259189) has the molecular formula C15H15FN2O3
and a molecular weight of 290.29 g/mol. Its IUPAC name is 1-N-(1,3-benzodioxol-5-ylmethyl)-2-fluoro-5-methoxybenzene-1,4-diamine.
Molecular Properties
| Compound Name | 1-N-(1,3-benzodioxol-5-ylmethyl)-2-fluoro-5-methoxybenzene-1,4-diamine |
| PubChem CID | 107259189 |
| Molecular Formula | C15H15FN2O3 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 1-N-(1,3-benzodioxol-5-ylmethyl)-2-fluoro-5-methoxybenzene-1,4-diamine |
| SMILES | COc1cc(NCc2ccc3c(c2)OCO3)c(F)cc1N |
| InChI | InChI=1S/C15H15FN2O3/c1-19-14-6-12(10(16)5-11(14)17)18-7-9-2-3-13-15(4-9)21-8-20-13/h2-6,18H,7-8,17H2,1H3 |
| InChIKey | YPGLCDAFRARWDT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-N-(1,3-benzodioxol-5-ylmethyl)-2-fluoro-5-methoxybenzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(1,3-benzodioxol-5-ylmethyl)-2-fluoro-5-methoxybenzene-1,4-diamine?
The IUPAC name of 1-N-(1,3-benzodioxol-5-ylmethyl)-2-fluoro-5-methoxybenzene-1,4-diamine (CID 107259189) is 1-N-(1,3-benzodioxol-5-ylmethyl)-2-fluoro-5-methoxybenzene-1,4-diamine.
What is the SMILES notation for 1-N-(1,3-benzodioxol-5-ylmethyl)-2-fluoro-5-methoxybenzene-1,4-diamine?
The canonical SMILES for 1-N-(1,3-benzodioxol-5-ylmethyl)-2-fluoro-5-methoxybenzene-1,4-diamine is COc1cc(NCc2ccc3c(c2)OCO3)c(F)cc1N.
What is the InChIKey of 1-N-(1,3-benzodioxol-5-ylmethyl)-2-fluoro-5-methoxybenzene-1,4-diamine?
The InChIKey is YPGLCDAFRARWDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15FN2O3/c1-19-14-6-12(10(16)5-11(14)17)18-7-9-2-3-13-15(4-9)21-8-20-13/h2-6,18H,7-8,17H2,1H3.
What are the key properties of 1-N-(1,3-benzodioxol-5-ylmethyl)-2-fluoro-5-methoxybenzene-1,4-diamine?
1-N-(1,3-benzodioxol-5-ylmethyl)-2-fluoro-5-methoxybenzene-1,4-diamine has a molecular weight of 290.29 g/mol, XLogP of 2.76, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(1,3-benzodioxol-5-ylmethyl)-2-fluoro-5-methoxybenzene-1,4-diamine is sourced from PubChem (CID 107259189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).