C11H13N3O5 — CID 107261265
2-hydroxy-3-[[2-(2-nitrophenyl)acetyl]amino]propanamide (PubChem CID 107261265) has the molecular formula C11H13N3O5 and a molecular weight of 267.24 g/mol. Its IUPAC name is 2-hydroxy-3-[[2-(2-nitrophenyl)acetyl]amino]propanamide.
| Compound Name | 2-hydroxy-3-[[2-(2-nitrophenyl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 107261265 |
| Molecular Formula | C11H13N3O5 |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 2-hydroxy-3-[[2-(2-nitrophenyl)acetyl]amino]propanamide |
| SMILES | NC(=O)C(O)CNC(=O)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13N3O5/c12-11(17)9(15)6-13-10(16)5-7-3-1-2-4-8(7)14(18)19/h1-4,9,15H,5-6H2,(H2,12,17)(H,13,16) |
| InChIKey | DAOWIPIKKRKZGB-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 135.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|