C13H12N2O2 — CID 107261390
N-(2-methylphenyl)-6-oxo-1H-pyridine-2-carboxamide (PubChem CID 107261390) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is N-(2-methylphenyl)-6-oxo-1H-pyridine-2-carboxamide.
| Compound Name | N-(2-methylphenyl)-6-oxo-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107261390 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | N-(2-methylphenyl)-6-oxo-1H-pyridine-2-carboxamide |
| SMILES | Cc1ccccc1NC(=O)c1cccc(=O)[nH]1 |
| InChI | InChI=1S/C13H12N2O2/c1-9-5-2-3-6-10(9)15-13(17)11-7-4-8-12(16)14-11/h2-8H,1H3,(H,14,16)(H,15,17) |
| InChIKey | BYFOIBJEAAPJSS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |