C14H14N2O3 — CID 107261705
N-[3-(methoxymethyl)phenyl]-6-oxo-1H-pyridine-2-carboxamide (PubChem CID 107261705) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is N-[3-(methoxymethyl)phenyl]-6-oxo-1H-pyridine-2-carboxamide.
| Compound Name | N-[3-(methoxymethyl)phenyl]-6-oxo-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107261705 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | N-[3-(methoxymethyl)phenyl]-6-oxo-1H-pyridine-2-carboxamide |
| SMILES | COCc1cccc(NC(=O)c2cccc(=O)[nH]2)c1 |
| InChI | InChI=1S/C14H14N2O3/c1-19-9-10-4-2-5-11(8-10)15-14(18)12-6-3-7-13(17)16-12/h2-8H,9H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | XRVBSMSTSSCGBX-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |