C15H21N3O2 — CID 107262049
6-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carbonyl)-1H-pyridin-2-one (PubChem CID 107262049) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 6-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carbonyl)-1H-pyridin-2-one.
| Compound Name | 6-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carbonyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 107262049 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 6-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carbonyl)-1H-pyridin-2-one |
| SMILES | CN1CCCC2CN(C(=O)c3cccc(=O)[nH]3)CCC21 |
| InChI | InChI=1S/C15H21N3O2/c1-17-8-3-4-11-10-18(9-7-13(11)17)15(20)12-5-2-6-14(19)16-12/h2,5-6,11,13H,3-4,7-10H2,1H3,(H,16,19) |
| InChIKey | ZZNHWJPYEJANSJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |