C8H10OS2 — CID 10726225
3-(1,3-dithian-2-yl)furan (PubChem CID 10726225) has the molecular formula C8H10OS2 and a molecular weight of 186.30 g/mol. Its IUPAC name is 3-(1,3-dithian-2-yl)furan.
| Compound Name | 3-(1,3-dithian-2-yl)furan |
|---|---|
| PubChem CID | 10726225 |
| Molecular Formula | C8H10OS2 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | 3-(1,3-dithian-2-yl)furan |
| SMILES | c1cc(C2SCCCS2)co1 |
| InChI | InChI=1S/C8H10OS2/c1-4-10-8(11-5-1)7-2-3-9-6-7/h2-3,6,8H,1,4-5H2 |
| InChIKey | NORGSJQLRBXSPM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |