C16H24O5 — CID 107263247
1-[2-(3-butoxy-2-hydroxypropoxy)-4-methoxyphenyl]ethanone (PubChem CID 107263247) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is 1-[2-(3-butoxy-2-hydroxypropoxy)-4-methoxyphenyl]ethanone.
| Compound Name | 1-[2-(3-butoxy-2-hydroxypropoxy)-4-methoxyphenyl]ethanone |
|---|---|
| PubChem CID | 107263247 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 1-[2-(3-butoxy-2-hydroxypropoxy)-4-methoxyphenyl]ethanone |
| SMILES | CCCCOCC(O)COc1cc(OC)ccc1C(C)=O |
| InChI | InChI=1S/C16H24O5/c1-4-5-8-20-10-13(18)11-21-16-9-14(19-3)6-7-15(16)12(2)17/h6-7,9,13,18H,4-5,8,10-11H2,1-3H3 |
| InChIKey | SRMKXWGNFATFQO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|