C13H19N3O2S2 — CID 107263338
1-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-3-butoxypropan-2-ol (PubChem CID 107263338) has the molecular formula C13H19N3O2S2 and a molecular weight of 313.45 g/mol. Its IUPAC name is 1-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-3-butoxypropan-2-ol.
| Compound Name | 1-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-3-butoxypropan-2-ol |
|---|---|
| PubChem CID | 107263338 |
| Molecular Formula | C13H19N3O2S2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 1-(4-aminothieno[2,3-d]pyrimidin-2-yl)sulfanyl-3-butoxypropan-2-ol |
| SMILES | CCCCOCC(O)CSc1nc(N)c2ccsc2n1 |
| InChI | InChI=1S/C13H19N3O2S2/c1-2-3-5-18-7-9(17)8-20-13-15-11(14)10-4-6-19-12(10)16-13/h4,6,9,17H,2-3,5,7-8H2,1H3,(H2,14,15,16) |
| InChIKey | UDMWOAPRDYYOQX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|