C11H20F3NO4 — CID 107263617
2-[(3-butoxy-2-hydroxypropyl)amino]-3,3,3-trifluoro-2-methylpropanoic acid (PubChem CID 107263617) has the molecular formula C11H20F3NO4 and a molecular weight of 287.28 g/mol. Its IUPAC name is 2-[(3-butoxy-2-hydroxypropyl)amino]-3,3,3-trifluoro-2-methylpropanoic acid.
| Compound Name | 2-[(3-butoxy-2-hydroxypropyl)amino]-3,3,3-trifluoro-2-methylpropanoic acid |
|---|---|
| PubChem CID | 107263617 |
| Molecular Formula | C11H20F3NO4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-[(3-butoxy-2-hydroxypropyl)amino]-3,3,3-trifluoro-2-methylpropanoic acid |
| SMILES | CCCCOCC(O)CNC(C)(C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C11H20F3NO4/c1-3-4-5-19-7-8(16)6-15-10(2,9(17)18)11(12,13)14/h8,15-16H,3-7H2,1-2H3,(H,17,18) |
| InChIKey | SQHJQNQSMQVDOM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|