methyl (E)-2-(3-chloropropyl)pent-2-enoate

C9H15ClO2 — CID 10726365

IUPACmethyl (E)-2-(3-chloropropyl)pent-2-enoate
SMILESCC/C=C(\CCCCl)C(=O)OC
InChIInChI=1S/C9H15ClO2/c1-3-5-8(6-4-7-10)9(11)12-2/h5H,3-4,6-7H2,1-2H3/b8-5+
InChIKeyBHGNYPDYDBSOEK-VMPITWQZSA-N
MW190.67 g/mol
LogP2.51
Rot. Bonds5

About methyl (E)-2-(3-chloropropyl)pent-2-enoate

methyl (E)-2-(3-chloropropyl)pent-2-enoate (PubChem CID 10726365) has the molecular formula C9H15ClO2 and a molecular weight of 190.67 g/mol. Its IUPAC name is methyl (E)-2-(3-chloropropyl)pent-2-enoate.

Molecular Properties

Compound Namemethyl (E)-2-(3-chloropropyl)pent-2-enoate
PubChem CID10726365
Molecular FormulaC9H15ClO2
Molecular Weight190.67 g/mol
Exact Mass190.08
IUPAC Namemethyl (E)-2-(3-chloropropyl)pent-2-enoate
SMILESCC/C=C(\CCCCl)C(=O)OC
InChIInChI=1S/C9H15ClO2/c1-3-5-8(6-4-7-10)9(11)12-2/h5H,3-4,6-7H2,1-2H3/b8-5+
InChIKeyBHGNYPDYDBSOEK-VMPITWQZSA-N
XLogP2.51
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.67
LogP ≤ 52.51
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (E)-2-(3-chloropropyl)pent-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (E)-2-(3-chloropropyl)pent-2-enoate?
The IUPAC name of methyl (E)-2-(3-chloropropyl)pent-2-enoate (CID 10726365) is methyl (E)-2-(3-chloropropyl)pent-2-enoate.
What is the SMILES notation for methyl (E)-2-(3-chloropropyl)pent-2-enoate?
The canonical SMILES for methyl (E)-2-(3-chloropropyl)pent-2-enoate is CC/C=C(\CCCCl)C(=O)OC.
What is the InChIKey of methyl (E)-2-(3-chloropropyl)pent-2-enoate?
The InChIKey is BHGNYPDYDBSOEK-VMPITWQZSA-N. The full InChI is InChI=1S/C9H15ClO2/c1-3-5-8(6-4-7-10)9(11)12-2/h5H,3-4,6-7H2,1-2H3/b8-5+.
What are the key properties of methyl (E)-2-(3-chloropropyl)pent-2-enoate?
methyl (E)-2-(3-chloropropyl)pent-2-enoate has a molecular weight of 190.67 g/mol, XLogP of 2.51, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-2-(3-chloropropyl)pent-2-enoate is sourced from PubChem (CID 10726365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).