C16H33NO2 — CID 107263935
1-butoxy-3-[(4,4-dimethylcyclohexyl)-methylamino]propan-2-ol (PubChem CID 107263935) has the molecular formula C16H33NO2 and a molecular weight of 271.44 g/mol. Its IUPAC name is 1-butoxy-3-[(4,4-dimethylcyclohexyl)-methylamino]propan-2-ol.
| Compound Name | 1-butoxy-3-[(4,4-dimethylcyclohexyl)-methylamino]propan-2-ol |
|---|---|
| PubChem CID | 107263935 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | 1-butoxy-3-[(4,4-dimethylcyclohexyl)-methylamino]propan-2-ol |
| SMILES | CCCCOCC(O)CN(C)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C16H33NO2/c1-5-6-11-19-13-15(18)12-17(4)14-7-9-16(2,3)10-8-14/h14-15,18H,5-13H2,1-4H3 |
| InChIKey | DCMAAYQFEAHYDJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|