About 6-propyl-3H-1,3-benzothiazol-2-one
6-propyl-3H-1,3-benzothiazol-2-one (PubChem CID 10726444) has the molecular formula C10H11NOS
and a molecular weight of 193.27 g/mol. Its IUPAC name is 6-propyl-3H-1,3-benzothiazol-2-one.
Molecular Properties
| Compound Name | 6-propyl-3H-1,3-benzothiazol-2-one |
| PubChem CID | 10726444 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 6-propyl-3H-1,3-benzothiazol-2-one |
| SMILES | CCCc1ccc2[nH]c(=O)sc2c1 |
| InChI | InChI=1S/C10H11NOS/c1-2-3-7-4-5-8-9(6-7)13-10(12)11-8/h4-6H,2-3H2,1H3,(H,11,12) |
| InChIKey | DFXLVFVYVNIZBQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-propyl-3H-1,3-benzothiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propyl-3H-1,3-benzothiazol-2-one?
The IUPAC name of 6-propyl-3H-1,3-benzothiazol-2-one (CID 10726444) is 6-propyl-3H-1,3-benzothiazol-2-one.
What is the SMILES notation for 6-propyl-3H-1,3-benzothiazol-2-one?
The canonical SMILES for 6-propyl-3H-1,3-benzothiazol-2-one is CCCc1ccc2[nH]c(=O)sc2c1.
What is the InChIKey of 6-propyl-3H-1,3-benzothiazol-2-one?
The InChIKey is DFXLVFVYVNIZBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NOS/c1-2-3-7-4-5-8-9(6-7)13-10(12)11-8/h4-6H,2-3H2,1H3,(H,11,12).
What are the key properties of 6-propyl-3H-1,3-benzothiazol-2-one?
6-propyl-3H-1,3-benzothiazol-2-one has a molecular weight of 193.27 g/mol, XLogP of 2.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propyl-3H-1,3-benzothiazol-2-one is sourced from PubChem (CID 10726444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).