C13H16N2O4 — CID 107265105
3-[(2-aminocyclopentanecarbonyl)amino]-4-hydroxybenzoic acid (PubChem CID 107265105) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 3-[(2-aminocyclopentanecarbonyl)amino]-4-hydroxybenzoic acid.
| Compound Name | 3-[(2-aminocyclopentanecarbonyl)amino]-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 107265105 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 3-[(2-aminocyclopentanecarbonyl)amino]-4-hydroxybenzoic acid |
| SMILES | NC1CCCC1C(=O)Nc1cc(C(=O)O)ccc1O |
| InChI | InChI=1S/C13H16N2O4/c14-9-3-1-2-8(9)12(17)15-10-6-7(13(18)19)4-5-11(10)16/h4-6,8-9,16H,1-3,14H2,(H,15,17)(H,18,19) |
| InChIKey | XBQVMZWSTRCTCW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|