C12H20O2 — CID 10726571
(4R,5S)-4-methoxyspiro[4.6]undecan-11-one (PubChem CID 10726571) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (4R,5S)-4-methoxyspiro[4.6]undecan-11-one.
| Compound Name | (4R,5S)-4-methoxyspiro[4.6]undecan-11-one |
|---|---|
| PubChem CID | 10726571 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (4R,5S)-4-methoxyspiro[4.6]undecan-11-one |
| SMILES | CO[C@@H]1CCC[C@@]12CCCCCC2=O |
| InChI | InChI=1S/C12H20O2/c1-14-11-7-5-9-12(11)8-4-2-3-6-10(12)13/h11H,2-9H2,1H3/t11-,12-/m1/s1 |
| InChIKey | SUXKRYRQAADUAW-VXGBXAGGSA-N |
| XLogP | 2.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |