C12H16ClNO — CID 107266013
4-chloro-N-(2-cyclopropylethyl)-3-methoxyaniline (PubChem CID 107266013) has the molecular formula C12H16ClNO and a molecular weight of 225.72 g/mol. Its IUPAC name is 4-chloro-N-(2-cyclopropylethyl)-3-methoxyaniline.
| Compound Name | 4-chloro-N-(2-cyclopropylethyl)-3-methoxyaniline |
|---|---|
| PubChem CID | 107266013 |
| Molecular Formula | C12H16ClNO |
| Molecular Weight | 225.72 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 4-chloro-N-(2-cyclopropylethyl)-3-methoxyaniline |
| SMILES | COc1cc(NCCC2CC2)ccc1Cl |
| InChI | InChI=1S/C12H16ClNO/c1-15-12-8-10(4-5-11(12)13)14-7-6-9-2-3-9/h4-5,8-9,14H,2-3,6-7H2,1H3 |
| InChIKey | DCLRNKLWMHFCFL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.72 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |