C13H10ClF3N2 — CID 107266358
6-chloro-2-methyl-N-[(3,4,5-trifluorophenyl)methyl]pyridin-3-amine (PubChem CID 107266358) has the molecular formula C13H10ClF3N2 and a molecular weight of 286.68 g/mol. Its IUPAC name is 6-chloro-2-methyl-N-[(3,4,5-trifluorophenyl)methyl]pyridin-3-amine.
| Compound Name | 6-chloro-2-methyl-N-[(3,4,5-trifluorophenyl)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 107266358 |
| Molecular Formula | C13H10ClF3N2 |
| Molecular Weight | 286.68 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 6-chloro-2-methyl-N-[(3,4,5-trifluorophenyl)methyl]pyridin-3-amine |
| SMILES | Cc1nc(Cl)ccc1NCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C13H10ClF3N2/c1-7-11(2-3-12(14)19-7)18-6-8-4-9(15)13(17)10(16)5-8/h2-5,18H,6H2,1H3 |
| InChIKey | IHCHBEWNEDXFOX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.68 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|