1-ethoxycarbonyl-3,6-dihydro-2H-pyridine-5-carboxylic acid

C9H13NO4 — CID 10726658

IUPAC1-ethoxycarbonyl-3,6-dihydro-2H-pyridine-5-carboxylic acid
SMILESCCOC(=O)N1CCC=C(C(=O)O)C1
InChIInChI=1S/C9H13NO4/c1-2-14-9(13)10-5-3-4-7(6-10)8(11)12/h4H,2-3,5-6H2,1H3,(H,11,12)
InChIKeyGURKPJKUMLVUIQ-UHFFFAOYSA-N
MW199.21 g/mol
LogP0.86
Rot. Bonds2

About 1-ethoxycarbonyl-3,6-dihydro-2H-pyridine-5-carboxylic acid

1-ethoxycarbonyl-3,6-dihydro-2H-pyridine-5-carboxylic acid (PubChem CID 10726658) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is 1-ethoxycarbonyl-3,6-dihydro-2H-pyridine-5-carboxylic acid.

Molecular Properties

Compound Name1-ethoxycarbonyl-3,6-dihydro-2H-pyridine-5-carboxylic acid
PubChem CID10726658
Molecular FormulaC9H13NO4
Molecular Weight199.21 g/mol
Exact Mass199.08
IUPAC Name1-ethoxycarbonyl-3,6-dihydro-2H-pyridine-5-carboxylic acid
SMILESCCOC(=O)N1CCC=C(C(=O)O)C1
InChIInChI=1S/C9H13NO4/c1-2-14-9(13)10-5-3-4-7(6-10)8(11)12/h4H,2-3,5-6H2,1H3,(H,11,12)
InChIKeyGURKPJKUMLVUIQ-UHFFFAOYSA-N
XLogP0.86
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.21
LogP ≤ 50.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-ethoxycarbonyl-3,6-dihydro-2H-pyridine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethoxycarbonyl-3,6-dihydro-2H-pyridine-5-carboxylic acid?
The IUPAC name of 1-ethoxycarbonyl-3,6-dihydro-2H-pyridine-5-carboxylic acid (CID 10726658) is 1-ethoxycarbonyl-3,6-dihydro-2H-pyridine-5-carboxylic acid.
What is the SMILES notation for 1-ethoxycarbonyl-3,6-dihydro-2H-pyridine-5-carboxylic acid?
The canonical SMILES for 1-ethoxycarbonyl-3,6-dihydro-2H-pyridine-5-carboxylic acid is CCOC(=O)N1CCC=C(C(=O)O)C1.
What is the InChIKey of 1-ethoxycarbonyl-3,6-dihydro-2H-pyridine-5-carboxylic acid?
The InChIKey is GURKPJKUMLVUIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO4/c1-2-14-9(13)10-5-3-4-7(6-10)8(11)12/h4H,2-3,5-6H2,1H3,(H,11,12).
What are the key properties of 1-ethoxycarbonyl-3,6-dihydro-2H-pyridine-5-carboxylic acid?
1-ethoxycarbonyl-3,6-dihydro-2H-pyridine-5-carboxylic acid has a molecular weight of 199.21 g/mol, XLogP of 0.86, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxycarbonyl-3,6-dihydro-2H-pyridine-5-carboxylic acid is sourced from PubChem (CID 10726658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).