C7H9N3S2 — CID 10726677
2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-ylhydrazine (PubChem CID 10726677) has the molecular formula C7H9N3S2 and a molecular weight of 199.30 g/mol. Its IUPAC name is 2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-ylhydrazine.
| Compound Name | 2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-ylhydrazine |
|---|---|
| PubChem CID | 10726677 |
| Molecular Formula | C7H9N3S2 |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | 2,3-dihydrothieno[3,2-f][1,4]thiazepin-5-ylhydrazine |
| SMILES | NNC1=NCCSc2sccc21 |
| InChI | InChI=1S/C7H9N3S2/c8-10-6-5-1-3-11-7(5)12-4-2-9-6/h1,3H,2,4,8H2,(H,9,10) |
| InChIKey | OLDCPDSFWHRPKK-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|