C15H22N2OS — CID 107267189
N-[4-[[(1-methylsulfanylcyclobutyl)methylamino]methyl]phenyl]acetamide (PubChem CID 107267189) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is N-[4-[[(1-methylsulfanylcyclobutyl)methylamino]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[(1-methylsulfanylcyclobutyl)methylamino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 107267189 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | N-[4-[[(1-methylsulfanylcyclobutyl)methylamino]methyl]phenyl]acetamide |
| SMILES | CSC1(CNCc2ccc(NC(C)=O)cc2)CCC1 |
| InChI | InChI=1S/C15H22N2OS/c1-12(18)17-14-6-4-13(5-7-14)10-16-11-15(19-2)8-3-9-15/h4-7,16H,3,8-11H2,1-2H3,(H,17,18) |
| InChIKey | CFCYCDZORKJVSE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |