C24H46N4O2 — CID 1072674
N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)butanediamide (PubChem CID 1072674) has the molecular formula C24H46N4O2 and a molecular weight of 422.66 g/mol. Its IUPAC name is N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)butanediamide.
| Compound Name | N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)butanediamide |
|---|---|
| PubChem CID | 1072674 |
| Molecular Formula | C24H46N4O2 |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.36 |
| IUPAC Name | N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)butanediamide |
| SMILES | CN1C(C)(C)CC(NC(=O)CCC(=O)NC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C24H46N4O2/c1-21(2)13-17(14-22(3,4)27(21)9)25-19(29)11-12-20(30)26-18-15-23(5,6)28(10)24(7,8)16-18/h17-18H,11-16H2,1-10H3,(H,25,29)(H,26,30) |
| InChIKey | PYPXCNRKIPCVHK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |