C12H16FNS — CID 107267608
1-(3-fluorophenyl)-N-[(1-methylsulfanylcyclopropyl)methyl]methanamine (PubChem CID 107267608) has the molecular formula C12H16FNS and a molecular weight of 225.33 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-N-[(1-methylsulfanylcyclopropyl)methyl]methanamine.
| Compound Name | 1-(3-fluorophenyl)-N-[(1-methylsulfanylcyclopropyl)methyl]methanamine |
|---|---|
| PubChem CID | 107267608 |
| Molecular Formula | C12H16FNS |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 1-(3-fluorophenyl)-N-[(1-methylsulfanylcyclopropyl)methyl]methanamine |
| SMILES | CSC1(CNCc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C12H16FNS/c1-15-12(5-6-12)9-14-8-10-3-2-4-11(13)7-10/h2-4,7,14H,5-6,8-9H2,1H3 |
| InChIKey | WZFCENDWWWASSO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |