C13H14O2 — CID 10726796
(4aS,9aR)-1,2,3,4,4a,9a-hexahydroxanthen-9-one (PubChem CID 10726796) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is (4aS,9aR)-1,2,3,4,4a,9a-hexahydroxanthen-9-one.
| Compound Name | (4aS,9aR)-1,2,3,4,4a,9a-hexahydroxanthen-9-one |
|---|---|
| PubChem CID | 10726796 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (4aS,9aR)-1,2,3,4,4a,9a-hexahydroxanthen-9-one |
| SMILES | O=C1c2ccccc2O[C@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C13H14O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1,3,5,7,10,12H,2,4,6,8H2/t10-,12+/m1/s1 |
| InChIKey | LDHODWRZZBYIIJ-PWSUYJOCSA-N |
| XLogP | 2.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |