C13H16F3NO2S2 — CID 107268766
N-[(1-methylsulfanylcyclobutyl)methyl]-2-(trifluoromethylsulfonyl)aniline (PubChem CID 107268766) has the molecular formula C13H16F3NO2S2 and a molecular weight of 339.40 g/mol. Its IUPAC name is N-[(1-methylsulfanylcyclobutyl)methyl]-2-(trifluoromethylsulfonyl)aniline.
| Compound Name | N-[(1-methylsulfanylcyclobutyl)methyl]-2-(trifluoromethylsulfonyl)aniline |
|---|---|
| PubChem CID | 107268766 |
| Molecular Formula | C13H16F3NO2S2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | N-[(1-methylsulfanylcyclobutyl)methyl]-2-(trifluoromethylsulfonyl)aniline |
| SMILES | CSC1(CNc2ccccc2S(=O)(=O)C(F)(F)F)CCC1 |
| InChI | InChI=1S/C13H16F3NO2S2/c1-20-12(7-4-8-12)9-17-10-5-2-3-6-11(10)21(18,19)13(14,15)16/h2-3,5-6,17H,4,7-9H2,1H3 |
| InChIKey | XPPNCYOGPMFJPJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |