C14H22O — CID 10726990
(1R,2S,6R,7R)-1,4,4,8-tetramethyl-11-oxatricyclo[5.3.1.02,6]undec-8-ene (PubChem CID 10726990) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is (1R,2S,6R,7R)-1,4,4,8-tetramethyl-11-oxatricyclo[5.3.1.02,6]undec-8-ene.
| Compound Name | (1R,2S,6R,7R)-1,4,4,8-tetramethyl-11-oxatricyclo[5.3.1.02,6]undec-8-ene |
|---|---|
| PubChem CID | 10726990 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (1R,2S,6R,7R)-1,4,4,8-tetramethyl-11-oxatricyclo[5.3.1.02,6]undec-8-ene |
| SMILES | CC1=CC[C@@]2(C)O[C@@H]1[C@@H]1CC(C)(C)C[C@@H]12 |
| InChI | InChI=1S/C14H22O/c1-9-5-6-14(4)11-8-13(2,3)7-10(11)12(9)15-14/h5,10-12H,6-8H2,1-4H3/t10-,11+,12+,14-/m1/s1 |
| InChIKey | DGTWJMBTLIXLPF-OWTLIXCDSA-N |
| XLogP | 3.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|