About 3-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)propanoic acid
3-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)propanoic acid (PubChem CID 10727013) has the molecular formula C8H9N5O2
and a molecular weight of 207.19 g/mol. Its IUPAC name is 3-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)propanoic acid |
| PubChem CID | 10727013 |
| Molecular Formula | C8H9N5O2 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 3-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)propanoic acid |
| SMILES | Nc1ncnc2nn(CCC(=O)O)cc12 |
| InChI | InChI=1S/C8H9N5O2/c9-7-5-3-13(2-1-6(14)15)12-8(5)11-4-10-7/h3-4H,1-2H2,(H,14,15)(H2,9,10,11,12) |
| InChIKey | ZKQQQDXTWJERMC-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)propanoic acid?
The IUPAC name of 3-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)propanoic acid (CID 10727013) is 3-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)propanoic acid.
What is the SMILES notation for 3-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)propanoic acid?
The canonical SMILES for 3-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)propanoic acid is Nc1ncnc2nn(CCC(=O)O)cc12.
What is the InChIKey of 3-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)propanoic acid?
The InChIKey is ZKQQQDXTWJERMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5O2/c9-7-5-3-13(2-1-6(14)15)12-8(5)11-4-10-7/h3-4H,1-2H2,(H,14,15)(H2,9,10,11,12).
What are the key properties of 3-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)propanoic acid?
3-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)propanoic acid has a molecular weight of 207.19 g/mol, XLogP of -0.12, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-aminopyrazolo[3,4-d]pyrimidin-2-yl)propanoic acid is sourced from PubChem (CID 10727013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).