C10H12N2O3 — CID 10727056
trans-(1S,2R)-2-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)cyclopropane-1-carbaldehyde (PubChem CID 10727056) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is trans-(1S,2R)-2-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)cyclopropane-1-carbaldehyde.
| Compound Name | trans-(1S,2R)-2-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)cyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 10727056 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | trans-(1S,2R)-2-(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)cyclopropane-1-carbaldehyde |
| SMILES | Cn1c([C@@H]2C[C@@H]2C=O)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C10H12N2O3/c1-11-8(7-3-6(7)5-13)4-9(14)12(2)10(11)15/h4-7H,3H2,1-2H3/t6-,7-/m1/s1 |
| InChIKey | NXUZWFVFBGKSCM-RNFRBKRXSA-N |
| XLogP | -0.61 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|