C12H18BrNO3 — CID 107270892
3-[[1-(5-bromofuran-2-yl)ethylamino]methyl]-2-methyloxolan-3-ol (PubChem CID 107270892) has the molecular formula C12H18BrNO3 and a molecular weight of 304.18 g/mol. Its IUPAC name is 3-[[1-(5-bromofuran-2-yl)ethylamino]methyl]-2-methyloxolan-3-ol.
| Compound Name | 3-[[1-(5-bromofuran-2-yl)ethylamino]methyl]-2-methyloxolan-3-ol |
|---|---|
| PubChem CID | 107270892 |
| Molecular Formula | C12H18BrNO3 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 3-[[1-(5-bromofuran-2-yl)ethylamino]methyl]-2-methyloxolan-3-ol |
| SMILES | CC(NCC1(O)CCOC1C)c1ccc(Br)o1 |
| InChI | InChI=1S/C12H18BrNO3/c1-8(10-3-4-11(13)17-10)14-7-12(15)5-6-16-9(12)2/h3-4,8-9,14-15H,5-7H2,1-2H3 |
| InChIKey | GOZCBOWGAORZLE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |